Solve for x using
multiplication.
cross
X - 2
x3
x + 2
=
4
3
x = [?]

Answer:

cosβ

Step-by-step explanation:

cot(β+π)sinβ

cot(x)=cos(x)/sin(x), so we can rewrite our expression as:

(cos(β+π)/sin(β+π)) * sinβ

sin(a+b)=sin(a)cos(b)+cos(a)sin(b), so we can rewrite our expression as:

(cos(β+π)/(sinβcosπ+cosβsinπ)) * sin(β)

cos(a+b)=cos(a)cos(b)-sin(a)sin(b), so we can rewrite our expression as:

(cosβcosπ-sinβsinπ)/(sinβcosπ+cosβsinπ)) * sin(β)

cosπ=-1 and sinπ=0, so we can rewrite our expression as:

(-cosβ)/(-sinβ) * sin(β)

(-cosβ)/(-sinβ) * sin(β)

=(cosβ/sinβ)(sinβ)

=cosβ

Answer:

4m + 14

Step-by-step explanation:

m = # movies Mia has

2m = # movies Eli has

14 + m = # movies Doug has

Total:  m + 2m + 14 + m = 4m + 14

Answer:

V = 262.61 m³

Step-by-step explanation:

Given: Slant height of the cone is 9 inches, the diameter is 6.2 inches.  

To find: Volume of the cone

Formula: The formula for the volume of a cone is V = 1/3hπr².  

Solve: The base area of the cone. π defines the ratio of any circle's circumference to its diameter and is approximately equal to 3.141593, however, the value 3.14 is often used.

V = π × r² × h / 3

π × r²

V = 262.610935 m³

In the nearest tenths, the volume of the cone is V = 262.61 m²

investing $27,000 in an account paying 7.25% interest compounded quarterly.

What will Jamie's account balance be in 14 years?

Answer:

$74,495.30

Jamie's account balance will be $73,828.74 after 14 years.

Compound interest is the addition of interest to the principal sum of a loan or deposit, or in other words, interest on principal plus interest.

Here, Principal = $27,000

         Rate of interest = 7.25% compounded quarterly

                                    = 0.0725/4 = 0.018125 per annum

         Time = 14 years or 56 quarters

Now, A = P(1+i)ⁿ

        A = 27000(1+0.018125)⁵⁶

        A = 27000 X 2.7343

        A = 73828.74

Thus, Jamie's account balance will be $73,828.74 after 14 years.

Learn more about Compound Interest from:

https://brainly.com/question/14295570

#SPJ2

Answer:

[tex](a)\ x + 4 = \±\sqrt9[/tex] ---- [tex]x =\{-7,- 1\}[/tex]

[tex](b)\ x - 4 = \±\sqrt9[/tex] ---- [tex]x = \{1,7\}[/tex]

[tex](c)\ x + 3 = \±\sqrt{16}[/tex] ----- [tex]x = \{-7,1\}[/tex]

[tex](d)\ x - 3 = \±\sqrt{16}[/tex] ---- [tex]x = \{-1,7\}[/tex]

Step-by-step explanation:

Given

The attached equations

Required

Match each with the solution

[tex](a)\ x + 4 = \±\sqrt9[/tex]

Take the square root of 9

[tex]x + 4 = \±3[/tex]

Solve for x

[tex]x =- 4 \±3[/tex]

Split

[tex]x =\{- 4 -3,- 4 +3\}[/tex]

[tex]x =\{-7,- 1\}[/tex]

[tex](b)\ x - 4 = \±\sqrt9[/tex]

Take the square root of 9

[tex]x - 4 = \±3[/tex]

Solve for x

[tex]x = 4 \±3[/tex]

Split

[tex]x = \{4 -3,4+3\}[/tex]

[tex]x = \{1,7\}[/tex]

[tex](c)\ x + 3 = \±\sqrt{16}[/tex]

Take the square root of 16

[tex]x + 3 = \±4[/tex]

Solve for x

[tex]x =- 3 \±4[/tex]

Split

[tex]x = \{-3-4,-3+4\}[/tex]

[tex]x = \{-7,1\}[/tex]

[tex](d)\ x - 3 = \±\sqrt{16}[/tex]

Take the square root of 16

[tex]x - 3 = \±4[/tex]

Solve for x

[tex]x =3 \±4[/tex]

Split

[tex]x = \{3-4,3+4\}[/tex]

[tex]x = \{-1,7\}[/tex]

Answer:

4th number line (the one of the bottom right)

Step-by-step explanation:

First, solve the inequality, then choose the number line that mathes the solution.

3x ≤ -6

Only step: Divide by 3.

x ≤ -6/3

x ≤ -2

But which number line matches the solution?

We know this is going left, so #1 & #3 are out. This also has a closed circle (because of ≤ (less than/equal to)), so #2 is also out.

Number line #4 matches the solution (x ≤ -2), so it is the answer.

Answer:

tana=h/x

tan6.5=h/4

h=4tan6.5

h=0.5 mi

Step-by-step explanation:

I hope this helps u! :D

Answer:

322.28

A

Step-by-step explanation:

Area of the rectangle

L = 30

W = 21

Area = 30 * 21

Area = 630

Area of the circles

Radius = 7 m

Area = pi r^2

Area = 3.14 * 7^2

Area = 153.86 m^2

Area of both circles = 307.72

Area of the Shaded Region

Area of shaded region = area of the rectangle - area of 2 circles.

Area of Shaded Region = 630 - 307.72

Area of Shaded Region = 322.28

Answer:

-3

Step-by-step explanation:

-4a - 2a - 7 = 11

-6a - 7 = 11                                      Combine coefficients.

      +7   +7

-6a = 18                                           Isolate the variable.

a  = -3                                 Divided by 6 on both sides to isolate the variable.

Answer:

OPS and TSP,

QPS and PSR

Step-by-step explanation:

The alternate interior angles look like the picture provided below. Next time, don't clickbait with the wrong amount of points.

QPS is included but isn't one of the answers because they it's not a multiple choice question.

Answer:

27

Step-by-step explanation:

Answer:

22°

Step-by-step explanation:

<1 is a secant-secant angle (it lies outside the circle, created by two lines that cut through the circle). The measure of a secant-secant angle is half the difference of the measures of the intercepted arcs:

<1=(0.5)(98-54)

<1=(0.5)(44)

<1=22°

Answer:

Im pretty sure it's C U think it is

Answer: Penny is closer

Step-by-step explanation:

1 mile is 1760 yards- so 2 miles is 3520 yards, so Penny is closer... which makes no sense since they live in the same building, but there you have it

Answer:

1 out of 8 chance it will be listed exactly

Answer:

1/35

Step-by-step explanation:

P= 6 *13! / 15! = 1/35

The probability of two east high school swimmers to come first and second is 1/35.

How to calculate probability?

First, let us calculate the number of desired outcomes:

The first position has 3 possibilities and 2nd position has 2 possibilities and 3rd position has 13 possibilities (leaving people of 1st and 2nd position).

Total=2.3.13

Now, calculate the total outcome:

1st position has 15 possibilities, 2nd has 14 and 3rd has 13.

Total=15.14.13

Probability=desired outcome/total outcome

                 =2.3.13/15.14.13

                 =1/35

Therefore, probability of the given situation is 1/35.

To know more about probability refer:

https://brainly.com/question/13604758

#SPJ2

Answer:

3.49

Step-by-step explanation:

subtract 2.01 from 5.5

Answer:

The area of the printed picture is 172.5 square inches.

Step-by-step explanation:

Since a picture is to be printed onto a sheet of paper with dimensions of 81/2 x 11 inches, and a margin of 1 1/2 inches is to be left on all sides of the picture, to determine what is the area of the printed picture the following calculation must be carried out, knowing that the area of a rectangle is equal to the base multiplied by the height:

81/2 = 40.5

1/2 = 0.5

40.5 - 1.5 x 4 = 34.5

11 - 1.5 x 4 = 5

34.5 x 5 = 172.5

Therefore, the area of the printed picture is 172.5 square inches.

Required area = 9× 5 + 6×3

= 45+18

= 63

Answer:

You know you forgot to put a pictures I would recommend to put a picture to get desired answers!

Step-by-step explanation:

Answer:7,10,13,16

:))))

Answer:

x represents nickels = 2

3x represents number of quarters = 6

Step-by-step explanation:

x represents nickels

3x represents number of quarters

We'll multiply each of those times the value of the coin they represent, and make that equal to the total amount of money Mark has to get the value of x

x(0.05) + 3x(0.25) = 1.60

0.05x + 0.75x = 1.60

0.80x = 1.60

x = 2 = number of nickels

So 3x = 6 = number of quarters

Checking the math:

2(0.05) + 6(0.25)= 0.10 + 1.50 = 1.60

Answer:

1 outta of 4

Step-by-step explanation:

Answer:

Step-by-step explanation:

1 out of 4

there are four letters and the probability he will chose one is one out of the four letters.

9514 1404 393

Answer:

  (a) 3%

Step-by-step explanation:

Nathan's actual mileage was ...

  (2882 mi)/(131 gal) = 22.0 mi/gal

The error can be computed from ...

  error % = (predicted/actual -1) × 100% = (22.6/22 -1) × 100% ≈ 2.73%

Nathan's prediction was high by about 3%.

Answer: A

Step-by-step explanation:

A and D

A= 3+1=4

D=4*3=12