Find y
Round to the nearest tenth:
28°
X
350 ft
y
y = [ ? ]ft
Enter

Find YRound To The Nearest Tenth:28X350 Ftyy = [ ? ]ftEnter

Answers

Answer 1

Answer:

y = 658.3 ft

Step-by-step explanation:

Angle of depression = angle of elevation = 28° (alternate angles are congruent)

Reference angle = 28°

Side length opposite to reference angle = 350 ft

Adjacent = y

Apply trigonometric function, TOA:

Tan 28 = Opp/Adj

Tan 28 = 350/y

y*Tan 28 = 350

y = 350/Tan 28

y = 658.254263 ≈ 658.3 ft (nearest tenth)


Related Questions

Question 7 of 8
Calculate the amount of interest earned on a $7,500 investment made for 2 years at
5.5% p.a..

Answers

Answer:

$825

Step-by-step explanation:

Formula we use:

I = Prt

Given:

P = 7500

r = 5.5% or 0.055

t = 2

Work:

I = Prt

I = 7500(0.055)(2)

I = 412.5(2)

I = 825

There are two spinners containing only white and green slices. Spinner A has 4 white slices and 1 green slice. All the slices are the same size. Spinner B has 3 white slices and 9 green slices. All the slices are the same size. Each spinner is spun. List these events from least likely to most likely. Event : Spinner B lands on a green slice. Event : Spinner A lands on a white or green slice. Event : Spinner A lands on a white slice. Event : Spinner B lands on a yellow slice.

Answers

Answer:

Step-by-step explanation:

Ok, lets list the important things

only green and white slicesall slices same sizespinner A has 4/5 white slices and 1/5 green slicesspinner B has 3/12 white slices and 9/12 green slices

The 4 options are:

spinner B lands on a green slicespinner A lands on a white or green slicespinner A lands on a white slicespinner B lands on a yellow slice

We already know that choice 2 is 100% probable and option 4 is 0% probability, because in option 2, the spinner A ONLY has white or green slices so the spinner must land on the slice. In option 4, no matter which spinner is spun no yellow slices are available to land on.

the chance of option 1 happening is 9/12 which is 3/4 which is 75%

the chance of option 3 of happening 4/5 which is 80%

option 1 has a 75% chance

option 2 has a 100% chance

option 3 has an 80% chance

option 4 has a 0% chance

this means that the order is:

1. option 4

2. option 3

3. option 1

4. option 2

because it is least likely to most likely.

hope this helped you out and if you need any questions feel free to ask

good luck in maths!

-cheesetoasty

For each of the following forms determine whether the following limit type is indeterminate, always has a fixed finite value, or never has a fixed finite value.
In the first case answer IND, in the second case enter the numerical value, and in the third case answer DNE.
For example:
IND: 0/0
0: 0/1
DNE: 1/0
Note that Hospital's rule (in some form) may ONLY be applied to indeterminate forms.
1. 1/-[infinity]
2. 0 - [infinity]
3. 0[infinity]
4. [infinity][infinity]
5. 0−[infinity]
6. [infinity]−[infinity]
7. [infinity]−e
8. 1[infinity]
9. π−[infinity]
10. π[infinity]
11. 1 −[infinity]
12. [infinity]1
13. [infinity]−[infinity]
14. 0/[infinity]
15. [infinity]0
16. 00
17. 10
18. 1 - [infinity]
19. [infinity]/0
20. inf - inf

Answers

Step-by-step explanation:

1. 1/-[infinity] = 0

2. 0 - [infinity] = -∞

3. 0[infinity] = 0

4. [infinity][infinity] = IND

5. 0−[infinity] = -∞

6. [infinity]−[infinity] = ∞

7. [infinity]−e = ∞

8. 1[infinity] = ∞

9. π−[infinity] = -∞

10. π[infinity] = ∞

11. 1 −[infinity] = -∞

12. [infinity]1 = ∞

13. [infinity]−[infinity] = ∞

14. 0/[infinity] = IND

15. [infinity]0 = 0

16. 00 = 0

17. 10 = 10

18. 1 - [infinity] = -∞

19. [infinity]/0 = DNE

20. inf - inf = ∞

What is the volume of a rectangular
water tank which is 8 metres long, 4
metres wide and 3 metres high.​

Answers

Answer:

3x-x+2=4

Step-by-step explanation:

What is the first step to solve this equation:
11 - 3x = 44


Add 3 to both sides


Add 11 to both sides


Subtract 11 from both sides


Divide 3 on both sides.

Answers

Substracs 11 from both sides

The state education commission wants to estimate the fraction of tenth grade students that have reading skills at or below the eighth grade level. In an earlier study, the population proportion was estimated to be 0.19. How large a sample would be required in order to estimate the fraction of tenth graders reading at or below the eighth grade level at the 98% confidence level with an error of at most 0.02

Answers

Answer:

A sample of 2084 is needed.

Step-by-step explanation:

In a sample with a number n of people surveyed with a probability of a success of [tex]\pi[/tex], and a confidence level of [tex]1-\alpha[/tex], we have the following confidence interval of proportions.

[tex]\pi \pm z\sqrt{\frac{\pi(1-\pi)}{n}}[/tex]

In which

z is the zscore that has a pvalue of [tex]1 - \frac{\alpha}{2}[/tex].

The margin of error is:

[tex]M = z\sqrt{\frac{\pi(1-\pi)}{n}}[/tex]

In an earlier study, the population proportion was estimated to be 0.19.

This means that [tex]\pi = 0.19[/tex]

98% confidence level

So [tex]\alpha = 0.02[/tex], z is the value of Z that has a pvalue of [tex]1 - \frac{0.02}{2} = 0.99[/tex], so [tex]Z = 2.327[/tex].

How large a sample would be required in order to estimate the fraction of tenth graders reading at or below the eighth grade level at the 98% confidence level with an error of at most 0.02?

This is n for which M = 0.02. So

[tex]M = z\sqrt{\frac{\pi(1-\pi)}{n}}[/tex]

[tex]0.02 = 2.327\sqrt{\frac{0.19*0.81}{n}}[/tex]

[tex]0.02\sqrt{n} = 2.327\sqrt{0.19*0.81}[/tex]

[tex]\sqrt{n} = \frac{2.327\sqrt{0.19*0.81}}{0.02}[/tex]

[tex](\sqrt{n})^2 = (\frac{2.327\sqrt{0.19*0.81}}{0.02})^2[/tex]

[tex]n = 2083.4[/tex]

Rounding up:

A sample of 2084 is needed.

Megan got paid $2,156 for babysitting this year. If she makes $11 an hour, how many hours did she babysit this year​

Answers

Answer:

she worked 196 hours

Step-by-step explanation:

just divide 2156 by 11 :p i hope im right lol.

Answer:

196 hours

Step-by-step explanation:

$2156÷$11=196 hours

A crate contains 100,000 sheets of paper.
If the crate has a mass of 357,100 gm, what is the mass of
a single sheet of paper?

Answers

Answer:

3.571 g

Step-by-step explanation:

357,100 / 100,000 = 3.571

Answer:

3.571g

Step-by-step explanation:

357100 grams / 100000 sheets of paper = 3.571g per sheet of paper

What is the sum of 7 of the interior angles of a regular decagon?

Answers

Answer:

The answer is 1008 degrees

Step-by-step explanation:

The sum of 7 of the interior angles of a regular decagon is 1008°.

What is interior angle of polygon?It is an angle inside a shape. All the interior angles in a regular polygon are equal.Formula to find the sum of interior angles of a polygon:

S = (n - 2) × 180°, where n is the number of sides of the regular polygon.

What is decagon?

"It is a polygon having ten sides, ten interior angles and ten vertices."

For given example,

We need to find the sum of 7 of the interior angles of a regular decagon.

Number of sides of decagon (n) = 10

Using the formula of sum of interior angles,

⇒ S = (n - 2) × 180°

⇒ S = (10 - 2) × 180°

⇒ S = 1440°

This means the sum of all interior angles of a regular decagon is  1440°.

We know, there are 10 interior angles of regular decagon.

Let  'x' represents the measure of each interior angle of a regular decagon.

⇒ 10x = 1440°

⇒ x = 1440/10

⇒ x = 144°

This means, the interior angle of a regular decagon measures 144°

So, the sum of 7 of the interior angles would be,

7 × 144° = 1008°

Therefore, the sum of 7 of the interior angles of a regular decagon is 1008°.

Learn more about the interior angles of a regular decagon here:

https://brainly.com/question/12080566

#SPJ2

3. Maxine has assets worth $145,000 and liabilities totaling $75,000. What is Maxine's net worth?
A $155,000
B-$15,000
C $70,000
D-$85,000

Answers

Answer: C.) $70,000

Explanation:
Assets - Liabilities = Net worth
$145,000 - $75,000 = $70,000
It would be C

145,000- 75,000=70000

If you walk around a circular path TWICE, and the circle has a diameter of 100 m, how far did you walk in TOTAL?

Answers

Answer:

628.32 m

Step-by-step explanation:

C = πd

C = π*(100m)

C = 314.16 m

Total Distance = 2*C

2*C = 628.32 m

Leave a like and brainist if this helped

a sunglasses store bought $5,000 worth of glasses the store made $9,000 making a profit of $20 per sunglasses there were How many pairs of sunglasses involved?

Answers

Answer:

150 pairs

Step-by-step explanation:

so total money spent Is equal to 5000

profit is equal to 3000

profit on each pair is equal to 20

so 3000 divided by 20

which gives 150

so 150 pairs of sunglasses were involved

pls give me brainliest I need it

Answer:

The sunglasses involved are 200

please help i will give brainliest.

Answers

Answer:

754 ft²

Step-by-step explanation:

Given

d = 24 fth = 4 ft

Required amount of vinyl:

πdh + πd²/4 =3.14*24*4 + 3.14*24²/4 = 754 ft² (rounded)

F(x) = xlnx/x+1
Find the derivative

Answers

Answer:

ln(x)

Step-by-step explanation:

if you need the steps  .. it's very long... but the answer is easy

ln(x)  

FIRST CORRECT ANSWER GETS BRAINLIEST!!!!!!!! Suppose you were digging at a rate of 10 feet per day. Assume you are ar sea level when you begin digging. If there are 365 days in a year, write an equation to represent the depth of the hole where d= depth in feet and t= time in years

Answers

Answer:

simple

Step-by-step explanation:

365 x 10 = 3650 feet

took you 1 year

and adding on sea level 1,312 feet

3650 + 1,312 = 4962 in 1 year

hope im right

Which function shows the function f(x) = 3^x being
translated 5 units to the left?
A. f(x) = 3^x – 5
B. f(x) = 3^(x+5)
C. f(x) = 3^(x - 5)
D. f(x) = 3^x + 5

Answers

Answer:

B.

Step-by-step explanation:

When you want to move a function on a graph from left to right, you "move" the x, and when moving the x; it's the opposite. So, C would move the function 5 units to the right because it is subtracting.

The correct option will be f(x) = 3^(x - 5)

What is translation?

A translation is a transformation that moves every point in a figure the same distance in the same direction.

Given that, the function f(x) = 3ˣ, being translated 5 units to the left.

Since, the function is being translated in left, therefore, we subtract 5 from x,

i.e. f(x) = 3⁽ˣ⁻⁵⁾

Hence, f(x) = 3⁽ˣ⁻⁵⁾ is the function shows the function f(x) = 3ˣ being

translated 5 units to the left.

For more references on translation, click;

https://brainly.com/question/12463306

#SPJ2

find the missing side of each triangle

Answers

12 i think!! i hope this helped

true or false: sin 50* = sin 130*

Answers

Answer:

True

Step-by-step explanation:

sin(130)

sin(180-50)

By difference rule for sine

sin(180)cos(50)-sin(50)cos(180)

0*cos(50)-sin(50)*-1

0+sin(50)

sin(50)

The answer is true.

please help with this problem

Answers

Answer:

choice 1) 0, -4/5

Step-by-step explanation:

1/(t² + t) = 1/t - 5

multiply both sides of the equation by (t² + t):

1 = (t² + t)/t - 5t² - 5t

1 = t + 1 - 5t² -5t

-5t² - 4t = 0

t(-5t - 4) = 0

t = 0

-5t = 4

divide both sides by -5:

t = -4/5

HELP PLEASE QUICKLY!!!!!!!!! NO LINKS

Answers

Answer:

80mi

Step-by-step explanation:

65+0.70m <121

0.70m< 56

m<80

The sales tax for an item was $27.20 and it cost $340 before tax.

What is the sales tax rate?

Write your answer as a percentage.​

Answers

Answer:

8%

Step-by-step explanation:

27.20/340=0.08

=8%

Mathematical Literacy , What does a basic fee mean?​

Answers

Answer:

Basic Fee means the compensation provided to Construction Manager for providing Basic Services. + New List. Basic Fee means the compensation provided to Pre-Construction Contractor for providing Basic Services.Step-by-step explanation:

The initial value of a product or service which calls for a fee. Typically this will be understood as the y-intercept in a linear equation.

Which problem can be solved with 56 + 7 = 8?
Chloe has 56 pennies. Her brother has 7 times as
many pennies as she has, How many pennies does
her brother have?
Chloe has 56 pennies. She finds 7 more pennies.
How many pennies does she have now?
Chloe has 56 pennies. She puts the pennies into
equal stacks of 7. How many stacks does she make?
Chloe has 56 pennies. She gives away 7 pennies.
How many pennies does she have left?

Answers

Answer:

she puts the pennies into equal stacks

Step-by-step explanation:

I think you meant 56 DIVIDED by 7=8, not 56 PLUS 7=8

Answer:

C.Chloe has 56 pennies. She puts the pennies intoequal stacks of 7. How many stacks does she make?

Step-by-step explanation:

i need help now please

Answers

Answer:

12

Step-by-step explanation:

A = ½(b1 + b2)h

A = (3 + 5)(3)/2

A = 12

Hi can I get a thanks I’m also sure A=12!!!!!

How many if there are 2 is the of the is?
How are they related?
Is there a number that can become them?
Find the value of are.

Answers

yes i and i did not answer

Answer: no their is not a number that comes before the value

Step-by-step explanation:

PLEASE HELP ASAP!!!!!!!!!!!!!!!!!!!!!​

Answers

angle c=180-44-62=74 degrees

angle d=angle c=74 degrees

angle f=180-74-50=56 degrees

hope it helps:))

Answer:

C) 74°

D) 74°

F) 56°

Step-by-step explanation:

I assume you’re supposed to find the other three angle measurements.

C) 180-44-62=74

D) 74

F) 180-74-50=56

Figure A ~ Figure B
Find the volume of Figure A

Answers

9514 1404 393

Answer:

  1 m³

Step-by-step explanation:

The ratio of volumes is the cube of the ratio of corresponding linear dimensions.

  Va/Vb = ((2 m)/(8 m))³ = (1/4)³ = 1/64

  Va = Vb(1/64) = (64 cu. m)/(64) = 1 cu. m

The volume of figure A is 1 m³.

in the first box is 1 and the second one is 3

4+4 for 100 points brainlyist to first answer

Answers

Answer:

8

Step-by-step explanation:

plz me

Answer:

4+4=8

Step-by-step explanation:

.................

What is the height of the tree?

Answers

Answer:

24 feet tall

Step-by-step explanation:

First you divide 6 by 10 and then you get 0.6, you then multiply 0.6 by 40 and you get 24.

The volume of the polyhedron is ______ yd3.

Answers

Answer:

122,850 yd³

Step-by-step explanation:

The polyhedron is a right triangle prism

Area of the right triangle prism = ½*a*c*h

a = 91 yd

c = 60 yd

h = 45 yd

Volume = ½*91*60*45

= 122,850 yd³

Other Questions
does anyone know how to do Statistical and Non-Statistical plz i really need help help please!! i just need to know if its a b c or d in which of the following does enstein's famous equation apply?A. a driver brings a car to a haltB. collisions between objects C. water falling in a waterfallD. nuclear fission and fusion reaction Two sentences with euphoric this story has a setting that is very important throughout american literature. Its setting is (POEM ABOVE)How does the word puddle-wonderful most impact the meaningof the poem?o It suggests the health benefits of rainy weather.O It captures the fun of playing in the rain.o It conveys the depth of the rain puddles.O It indicates that rain is beautiful. An example of a variable cost isA) payrollB) insuranceC) rentD) labor The blank has increased consumer knowledge about the connection between food and health. Steph wants to buy s tomato plants, and Diego wants to buy d tomato plants. Each plant costs $7. Steph will use a coupon that will give them $25 off the total cost of all their plants.Which expression represents the total cost of all the plants with the discount?A. 7(s + d) - 7(s + d)(0.25)B. 0.75(7s) + 7dC. 7(s + d) - 25D. 25(s + d) - 7 wanna be f.r.i.e.n.d.s???(also, the question won't go through so what's 5x7x9x6x78x5x6x8x8x5x6x8x5x7x8 equal?) Which example describes an abiotic factor interacting with a biotic factor?Small fish are food for larger fish.More light increases the water temperature.Tropical fish need warm water to survive.High water temperatures decrease oxygen concentration in the water. How did the Nile River affect ancient Egypts development?Choose all answers that are correct.Flooding delayed development until dams made it safe for people to live along the river.Because the Nile River is the only large waterway in Africa, most Africans settled there.The fertile delta soil produced enough crops to support the growth of a large civilization.People settled along the river for access to water. Divide 1 hour in the ratio 20%to 80% 1. Why did the Soviet Union continue to occupy Eastern Europe? Which choice is equivalent to the fraction below?6/17A. 17 divided 6B. 6 - 17C. 617D. 6 divided 17 What type of plate boundary is shown in the diagram?A. Transform boundary?B. Divergent boundary?C. Subduction boundary?D. Convergent boundary? Which of the following statement is correct about about the hierarchy of the taxonomic system currently used to classify organismsA. Many different classes of organisms belong to the same order B. All organisms of given phylum belong to the same kingdomC.Many different families of organisms belong to the same Genus D. All organisms and given order belong to the same species 5 types of fungus that play a role in the lives of humans write your thoughts about the following quote: "Being disappointed is one thing and being discouraged is something else. I am disappointed but I am not discouraged." -Tennessee Williams, The Glass Menagerie Which of the following correctly quotes this passage from page 20 of a journal article by M. Kersee?She had been accused of treason and was compelled to recite the alphabet backward in Italian.A. According to Kersee, "She had been accused of treason" (20).B. "She had been accused of treason," says Kersee, "and was compelled to recite the alphabet backward in Italian" (20).C. Not only had she been accused of treason, but she also had been "compelled to recite the alphabet backward in Italian" (Kersee 20).D. All of the above are correct.