8(w-5)=16 solve for w please give working out

Answers

Answer 1
The answer is 7 according

Related Questions

Question 6 of 10
sin 30º = √3/2 and cos 30º = 1/2

O A. True
OB. False

Answers

Answer: B) False

• sin 30º = 1/2
• cos 30º = √3/2

What is the product of (x² + x + 2) and (x² − 2x + 3)

Answers

Answer:

[tex]x^4-x^3+3x^2-x+6[/tex]

Step-by-step explanation:

Multiply each term in the first equation by all the terms in the second and add them together.

Find the value of x.

2x
70
120

Answers

The value of X is 10

which system of the equation is represents by the graph?


Answers

Sorry just needed points to use this app

Denise and Stacey went to a carnival. The admission fee was $6 per person. Each ride at the carnival costs c dollars. The game booths charged g dollars for each game. Both Denise and Stacey went on 7 rides each. Stacey played 3 games, while Denise played 2 games. Which expression represents the total amount of money that Denise and Stacey spent at the carnival?

Answers

The total amount of money that Denise and Stacey spent at the carnival is 12 + 14c + 5g dollars.

What is total amount?

The amount that you get when you add several numbers or things together.

The total amount of money that Denise and Stacey spent at the carnival will be money spent on admission + ride + game.

Total amount = 2 * 6 + 2 ( 7 * c ) +  ( 3 * g + 2 * g )

                      = 2 * 6 + 14 * c + 5 * g

                      = 12 + 14c + 5g dollars.

Therefore, the total amount of money that Denise and Stacey spent at the carnival is 12 + 14c + 5g dollars.

The questions seems incomplete, its option could be:

12 + 14c + 5g 12 + 14g + 5c 12 + 7g + 5c 12 + 7c + 5g.

Know more about total amount here:

https://brainly.com/question/357691

#SPJ1

Graph the equation.

Y= - 3/2x

Answers

Answer:

Step-by-step explanation:

help awdaWdawdadawdaWDaSwdaWDawdas

Answers

Answer:maybe c or d??

Step-by-step explanation:

I think the answer is C

3 is less than w and 9 is greater than w

Answers

The complete question is

"Write the inequality when 3 is less than w and 9 is greater than w."

The inequality become as 3 < w < 9.

What is inequality?

Inequality is defined as the relation which makes a non-equal comparison between two given functions.

Given information ;

when 3 is less than w and 9 is greater than w.

Thus, the inequality will be ;

3 < w < 9

Learn more about inequality ;

brainly.com/question/14164153

#SPJ1

Inside the box of every cereal box contains a surprise gift. The store manager assures employees that 18 of the 48 boxes on the shelf have a secret decoder ring and inside the other 30 boxes on the shelf contain a different gift. If two cereal boxes are randomly selected from the shelf to purchase, what is the probability that both of them have the secret decoder ring? (Give answer as a decimal correct to least three decimal places.)

Answers

The probability that both of them have the secret decoder ring will be 0.1356.

What is probability?

Its basic premise is that something will almost certainly happen. The percentage of favorable events to the total number of occurrences.

Inside the box of every cereal box contains a surprise gift.

The store manager assures employees that 18 of the 48 boxes on the shelf have a secret decoder ring.

And inside the other 30 boxes on the shelf contain a different gift.

If two cereal boxes are randomly selected from the shelf to purchase.

Then the probability that both of them have the secret decoder ring will be

The total events will be

Total event = ⁴⁸C₂

Total event = 1128

The favorable events will be

Favorable event = ¹⁸C₂

Favorable event = 153

Then the probability will be

P = 153 / 1128

P = 0.1356

More about the probability link is given below.

https://brainly.com/question/795909

#SPJ1

A triangle with side lengths a, b, and c is shown below.



Which statement about the side lengths must be true?

A a+b>c
B b+c C a+b D a+c

Answers

The statement about the sides must respect to represent a triangle is given as follows:

A. a + b > c.

What is the condition for 3 lengths to represent a triangle?

In a triangle, the sum of the lengths of the two smaller sides has to be greater than the length of the greater side.

The smaller sides for the triangle are given as follows:

a and b.

Hence the statement is:

a + b > c.

(as the sum of the lengths of the smaller sides a and b must be greater than the length of the larger side, which is of c).

Hence the correct statement is given by option A.

More can be learned about triangles at https://brainly.com/question/1058720

#SPJ1

HELP!Which linear function represents the line given by the point-slope equation y - 2 = 4(x − 3)? Of(x) = 6x-1 Of(x) = 8x-6 Of(x) = 4x - 14 Ofix) = 4x - 10 Which linear function represents the line given by the point - slope equation y - 2 = 4 ( x − 3 ) ? Of ( x ) = 6x - 1 Of ( x ) = 8x - 6 Of ( x ) = 4x - 14 Ofix ) = 4x - 10​

Answers

[tex]y-2=4(x-3)\\\\y-2=4x-12\\\\y=4x-10\\\\\boxed{f(x)=4x-10}[/tex]

Solve the quadratic equation numerically (using tables of x- and y- values). x squared + 7 x + 12 = 0 a. x = -1 or x = -1 c. x = -3 or x = -3 b. x = -4 or x = -3 d. x = 2 or x = -1 Please select the best answer from the choices provided

Answers

Answer:

b. x = -4 or x = -3

Step-by-step explanation:

[tex]x^{2} +7x+12[/tex]

To factor this, come up with two numbers that can be multiplied together to get 12, but add to get 7.

We get 4 and 3.

4 + 3 = 7

4 x 3 = 12

Now we can factor with these two numbers:

[tex](x+4)(x+3) = 0[/tex]

Now, solve for x by separating the factors:

[tex]x + 4 = 0[/tex]

[tex]x = -4[/tex]

And,

[tex]x + 3 = 0[/tex]

[tex]x = -3[/tex]

So, the answers are -4 and -3.

Michael went to the game store there was so much games he wanted and if one of them was $42.29 and the other one was $87.99 and he had $142 how much would he have left ​

Answers

Answer:

$11.72

Step-by-step explanation:

Add: $42.29 + $87.99 = $130.28

Subtract: $142 - $130.28 = $11.72

Answer:

he would have spent 131.08 dollars meaning he has 11.72 dollars left.

Step-by-step explanation:

Pleas help me please i dont know what this question is ​

Answers

Answer:

A = 6

B = 1

C = 14

Step-by-step explanation:

A = 25 - 19 = 6

B = 6 - 5 = 1

C = 19 - 5 = 14

give brainliest please! <3

Translate to an equation then solve the equation. Seven times the difference of some number and 2 amounts to the quotient of 196 and 14. (Type the question using x as the variable. Do not simplify.) x= ____

Answers

Create the equation, then solve for x

Answer:

x = 4

Step-by-step explanation:

7 * ( x-2) = 196/14

7x -14 = 14

7x = 28

x = 4

2x-3<1 or 3x-1<17
Solve compound inequality

Answers

The union consists of all of the elements that are contained in each interval.

Inequality Form:

x<6

Interval Notation:

(−∞,6)

what is the simplified equivalent of the terminating

Answers

The simplified fractional equivalent of 0.25 is 1/4 .

The complete question is

What is the simplified fractional equivalent of the terminating decimal 0.25?

What is simplified equivalent ?

When a number is solved to a state where it cannot be further simplified , but can be written in a different format , the two numbers are then called the simplified equivalent of each other.

The given number is decimal 0.25

So this number is in its simplified state but can also be written as

0.25 * 1

= 0.25 * 100 /100

= 25/100

= 1/4

Therefore 1/4 is the simplified fractional equivalent of 0.25.

To know more about simplified equivalent

https://brainly.com/question/11287955

#SPJ1

x + 4 = x2? Assume x greater-than 0

Answers

Answer:

The  value comes out to be  

[tex]x=\frac{1}{2}+\frac{\sqrt{17}}{2}[/tex]

Step-by-step explanation:

The quadratic equation is an equation containing a single variable of degree [tex]2[/tex]. Its general form is [tex]ax^{2} +bx + c=0[/tex].

The discriminant is the part of the quadratic formula underneath the square root symbol: b²- 4ac. The discriminant tells us whether there are two solutions, one solution, or no solutions.

The equation we are given is :[tex]x+4=x^{2} \\x^{2} -x-4=0\\[/tex]

We know the formula as :

[tex]x=[-b[/tex]±[tex]\sqrt{b^{2}-4ac}][/tex] ×[tex]\frac{1}{2a}[/tex]

[tex]x=[-(-1)[/tex]±[tex]\sqrt{(-1)^{2} -4(1)(-4)}][/tex]×[tex]\frac{1}{2(1)}[/tex]

[tex]x=\frac{1}{2}[/tex] ±[tex]\frac{\sqrt{17} }{2} }[/tex]

Since [tex]x[/tex]≥[tex]0[/tex]

Other negative option is neglected

[tex]x=\frac{1}{2}+\frac{\sqrt{17}}{2}[/tex]

Learn more about quadratic equations - https://brainly.com/question/1214333

#SPJ10

Describe the graph of a quadratic function below given in table form

Answers

1526273784483883 the form of the h=

Homework:Section 5.3 Homework
Question 5, 5.3.21
Part 1 of 2
HW Score: 50%, 4 of 8 points
Points: 0 of 1

Question content area top
Part 1
In airline​ applications, failure of a component can result in catastrophe. As a​ result, many airline components utilize something called triple modular redundancy. This means that a critical component has two backup components that may be utilized should the initial component fail. Suppose a certain critical airline component has a probability of failure of 0.0056 and the system that utilizes the component is part of a triple modular redundancy.
​(a) Assuming each​ component's failure/success is independent of the​ others, what is the probability all three components​ fail, resulting in disaster for the​ flight?
​(b) What is the probability at least one of the components does not​ fail?

Answers

The probability that all three components fail is 1.756 × 10⁻⁷. The probability of at least one of the components does not​ fail 0.9999998244.

What is a Probability?

Probability is the likelihood for an event to occur. In a given statistical distribution, the probability explains the range of values and probabilities that a randomized variable could have.

From the given information;

Assuming each​ component's failure/success is independent of the​ others: the probability that all three components fail is:

P(three components fail) = (0.0056)^3

P(three components fail) = 1.756 × 10⁻⁷

The probability that at least one does not fail is:

P(at least one does not fail) = 1 - P(all three components fail)

P(at least one does not fail) = 1 - 1.756 × 10⁻⁷

P(at least one does not fail) = 0.9999998244

Learn more about probability here:

https://brainly.com/question/24756209

#SPJ1

Solve the compound inequality. Graph the solution set and write it in interval notation. x<2 and x>-3

Answers

Answer:

Answer is (-3, 2)

(1)
Mrs Tan had $3756 to spend on furniture. She bought a sofa set for $1195 and 6 chairs at $128 each.

(a) How much did she spend altogether?

(b) How much money did she have left?

(Marshall Cavendish/ Pupil's book My Pals Are Here! Maths 4A 3rd Edition)

Answers

A) $1195 + 128(6 chairs)
= $1195 + 768
= $1963
B) 3756 - 1963 = 1793

3. Measure the length of each leg and
the hypotenuse of this triangle:
AD =
units
AE=
units
DE=
units
Correct!
Check

Answers

The length of each leg and the hypotenuse of this triangle will be:

AD = 2 units.

AE = 2 units.

DE = 2.8 units

How to compute the hypotenuse?

From the information given and the attached diagram, the value or AD and AE are 2 units respectively.

The value of DE will be calculated as the square root of 2² + 2². This will be:

= 2² + 2² = 8

= ✓8 = 2.8

Therefore, the correct options are 2, 2, and 2.8 units.

Learn more about triangles on:

brainly.com/question/1058720

#SPJ1

Given: angle 2 and angle 4 are vertical. Prove angle 2 congruent to angle 4
Need help quick!

Answers

The diagram shows that ∠2 and ∠4 are the vertical angles.

What are vertical angles?

Vertical angles are the angles that are opposite of each other when two lines cross.

The statements are:

1. < 2 & < 4 are vert. angles

2. Lines M & N intersect at P

3. < 2 & < 3 are a linear pair

4. m < 2 + m < 3 = 180

5. <3 and < 4 are a linear pair

6. m < 3 + m <4 =180

7. m < 2 + m < 3 = m < 3 + m < 4

8. m < 2 = m < 4

9. < 2 =~ <4

Here are the reasons:

1. Given

2. Def of vertical angles.

3. Def of. Linear pair

4. Angle addition postulate

5. Def of a linear pair

6. Angle addition postulate

7. Substitution property

8. Subtraction property

9. Def of =~ angles.

Learn more about angles on:

brainly.com/question/14362353

#SPJ1

Answer: View the picture below!

Step-by-step explanation: Just did the assignment!


Two numbers are in the ratio 3:8.
The larger number is 96, find the
sum of the numbers

Answers

Answer:

The sum of the numbers is 132

Step-by-step explanation:

First find the smallest number

3/8=x/96 2(96)=8x 288=8x x=36

Thus, you found the smallest number

then there sum given as 96+36=132

How does understanding of 5 x 12 = 60 help to solve for the product of 5
x 120? Explain in words

Answers

Answer:

c6

Step-by-step explanation:

justjustcancacanjustadda0totheproduct of5cxwewtogetthesameresultasx1totoandtimes

3) Number: 640,700

   the value of 4 in this number is 40,000

Number: 64,070

the value of 4 in this number is 4,000

So, times greater: 40,000 ÷ 4,000 = 10 times greater.

4)

The multiplication, 5 × 12 = 60. So, 5 × 120 = 600.

There is an extra zero at the very last of the result as '120' was multiplied with 5 instead of '12' which does not have zero at last which changes the result.

Similar cases with: 5 × 10 = 50. So, 5 × 100 = 500.

solve the following inequality:
ALGEBRA 1

Answers

Answer:

[tex]m \leqslant 10 \: or \: m > 4[/tex]

Step-by-step explanation:

[tex] \frac{m - 2}{3} \leqslant - 4 \\ \frac{m - 2}{3} \times 3 \leqslant - 4 \times 3 \\ m - 2 \leqslant - 12 \\ m - 2 + 2 \leqslant - 12 + 2 \\ m \leqslant 10[/tex]

OR

[tex]3m - 8 > 4 \\ 3m - 8 + 8 > 4 + 8 \\ 3m > 12 \\ \frac{3m}{3} > \frac{12}{3} \\ m > 4 [/tex]

Of all awarded prizes, 10% are worth $1000, 20% are worth $100, and 70% are worth $10. Find the expected winnings if you purchase a single ticke​

Answers

Answer:

$127

Step-by-step explanation:

[tex](.10 \times 1000) + (.20 \times 100) + (.70 \times 10) = 100 + 20 + 7 = 127[/tex]

NEED HELP!!!!!!!!!!!!!!!!!!!!!!

Answers

Answer:

The third answer

Step-by-step explanation:

if p is equivalent to q then q must be equivalent to p. I’m not 100% sure but that’s my best guess. I hope this helps :)

Use the given sample data to find Q3.

49 52 52 52 74 67 55 55

Answers

The given sample data the Q3=61

We begin by ordering the data from smallest to largest.

Next, find the median of the data.

The data set has 8 values, so the two middle values are 52 and 55.

49 52 52 52 55 55 67 74

What is the formula for the median?

Median = (52 + 55) / 2

Median= 53.5

The third quartile (Q3) is the 25th percentile or the median of the upper half of the data.

To find the median of all the values that lie above 53.5.

Q3 = (55 + 67)/ 2

Therefore the Q3=61

To learn more about the quartile visit:

https://brainly.com/question/10005803

#SPJ1

Other Questions
What is the mass in grams of 4.85 x 10^22 Al atoms? (Report your answer to two places past the decimal Read the passage from "What It Takes to Prepare for the Iditarod."In earty winter, mushers begin accumulating the food and equipment that will be shipped ahead to each checkpoint of the race. Each musher ships a total about 3,000 pounds of food and supples. All of this comes at a price. Estimates of the cost for a musher to enter a team in the Iditarod range upwards of $50,000 for a winning team. In order to pay for this, most mushers solicit sponsors. It is probably the musher's least favorite job. "You can end up feeling like you're seling your soul for money," cited one competitor.First question: Which best describes the tone of this passage?- The tone is frustrated, because It is very expensive to race in the Iditarod.- The tone is disappointed, because the mushers do not always get the money they need to race in the Iditarod.- The tone is boring, because the information is not important for racing in the Iditarod.- The tone is encouraging, because the mushers can rely on others to pay the costs of the Iditarod.Second question: How does the idiom selling your soul contribute to the meaning of this passage?-It shows that the mushers don't like having to rely on sponsors so they can race in the Iditarod-It shows how time-consuming it is for the mushers to work with sponsors when they race in the Iditarod.-It shows that the mushers work harder on finding sponsors, than on training to race in the Iditarod.-it shows how difficult it is for the mushers to find sponsors to cover the costs of the racing in the Iditarod Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please what are the main functions of drinking water and sanitation project in Western Nepal Which best explains why a firework being ignited is an example of an exothermic reaction and not an endothermicreaction ?O The fireworks produce colors.O The fireworks give off heat.O Igniting the fireworks requires energy.O Igniting the fireworks makes an odor. What countries in Europe have the highest population densities? Jeremy is reading a 60-page book. He read the first 20 pages in 30 minutes. If Jeremy continues to read a the same rate, how long will it take him to finish the book? Predict the shape of the molecule. write 9 430 049 in international number system Let f(x) = (x 3)2. Find all values of c in (1, 4) such that f(4) f(1) = f '(c)(4 1). (Enter your answers as a comma-separated list. If an answer does not exist, enter DNE.)c = Based off of this information, what conclusions can be made about the Mean Value Theorem?This contradicts the Mean Value Theorem since f satisfies the hypotheses on the given interval but there does not exist any c on (1, 4) such that f '(c) = f(4) f(1)4 1.This does not contradict the Mean Value Theorem since f is not continuous at x = 3. This does not contradict the Mean Value Theorem since f is continuous on (1, 4), and there exists a c on (1, 4) such that f '(c) = f(4) f(1)4 1.This contradicts the Mean Value Theorem since there exists a c on (1, 4) such that f '(c) = f(4) f(1)4 1, but f is not continuous at x = 3.Nothing can be concluded. What is the value of x?tox = [? ]36EnterI will give you points For which length of wire are the reading of resistance most precise An investor has $ to invest in a cd and a mutual fund. The cd yields % and the mutual fund yields %. The mutual fund requires a minimum investment of $, and the investor requires that at least twice as much should be invested in cds as in the mutual fund. How much should be invested in cds and how much in the mutual fund to maximize the return? what is the maximum return?. The properties of an element depend on the electron structure within its atoms. The electrons are arranged in differentorbitals, at different energy levels and sublevels. Match each sublevel to the maximum number of electrons it canaccommodate? Which represents a negative impact of technology?A. Accessible technologyB. Production of wasteC. Improvement in climateD. Access to more resources Four seasons why the indigenous breed would be superior to exotic breed(imported breeds) tuli breed We can tell whether a person is having an eating disorder just by looking at the weight. If a persons weight is between a healthy range, he/she will never have an eating disorder. Are the above statements true or false? Sequence: 1,5,13,25Find nth term (Equation/formula thingy)Need answer ASAP What is the meaning of the word strike in this passage The iso 14001:2004 standards require documentation of a firm's environmental program. Which component requires a plan to improve performance in resource use and pollutant output?